C18H28O4 — CID 139968531
(3E)-7-(methoxymethoxymethyl)-3-[1-(methoxymethoxy)propan-2-ylidene]-3a-methyl-2,6-dihydro-1H-indene (PubChem CID 139968531) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (3E)-7-(methoxymethoxymethyl)-3-[1-(methoxymethoxy)propan-2-ylidene]-3a-methyl-2,6-dihydro-1H-indene.
| Compound Name | (3E)-7-(methoxymethoxymethyl)-3-[1-(methoxymethoxy)propan-2-ylidene]-3a-methyl-2,6-dihydro-1H-indene |
|---|---|
| PubChem CID | 139968531 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (3E)-7-(methoxymethoxymethyl)-3-[1-(methoxymethoxy)propan-2-ylidene]-3a-methyl-2,6-dihydro-1H-indene |
| SMILES | COCOCC1=C2CC/C(=C(/C)COCOC)C2(C)C=CC1 |
| InChI | InChI=1S/C18H28O4/c1-14(10-21-12-19-3)16-7-8-17-15(11-22-13-20-4)6-5-9-18(16,17)2/h5,9H,6-8,10-13H2,1-4H3/b16-14+ |
| InChIKey | OZFNUWDZPPASMW-JQIJEIRASA-N |
| XLogP | 3.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|