C18H39NO — CID 139968832
N,N,2-triethyl-2-(methoxymethyl)decan-1-amine (PubChem CID 139968832) has the molecular formula C18H39NO and a molecular weight of 285.52 g/mol. Its IUPAC name is N,N,2-triethyl-2-(methoxymethyl)decan-1-amine.
| Compound Name | N,N,2-triethyl-2-(methoxymethyl)decan-1-amine |
|---|---|
| PubChem CID | 139968832 |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | N,N,2-triethyl-2-(methoxymethyl)decan-1-amine |
| SMILES | CCCCCCCCC(CC)(COC)CN(CC)CC |
| InChI | InChI=1S/C18H39NO/c1-6-10-11-12-13-14-15-18(7-2,17-20-5)16-19(8-3)9-4/h6-17H2,1-5H3 |
| InChIKey | XRNPTHAFQGSDDE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|