C17H37NO — CID 139968931
2-(methoxymethyl)-N,N-dimethyl-2-propan-2-yldecan-1-amine (PubChem CID 139968931) has the molecular formula C17H37NO and a molecular weight of 271.49 g/mol. Its IUPAC name is 2-(methoxymethyl)-N,N-dimethyl-2-propan-2-yldecan-1-amine.
| Compound Name | 2-(methoxymethyl)-N,N-dimethyl-2-propan-2-yldecan-1-amine |
|---|---|
| PubChem CID | 139968931 |
| Molecular Formula | C17H37NO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.29 |
| IUPAC Name | 2-(methoxymethyl)-N,N-dimethyl-2-propan-2-yldecan-1-amine |
| SMILES | CCCCCCCCC(COC)(CN(C)C)C(C)C |
| InChI | InChI=1S/C17H37NO/c1-7-8-9-10-11-12-13-17(15-19-6,16(2)3)14-18(4)5/h16H,7-15H2,1-6H3 |
| InChIKey | LEPKFFPUUYISGC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|