C22H26N2O3 — CID 139969233
cis-(1S,2R)-2-[[2-[4-(3,5-dimethylphenyl)phenyl]acetyl]amino]-N-hydroxycyclopentane-1-carboxamide (PubChem CID 139969233) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[2-[4-(3,5-dimethylphenyl)phenyl]acetyl]amino]-N-hydroxycyclopentane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-[[2-[4-(3,5-dimethylphenyl)phenyl]acetyl]amino]-N-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 139969233 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | cis-(1S,2R)-2-[[2-[4-(3,5-dimethylphenyl)phenyl]acetyl]amino]-N-hydroxycyclopentane-1-carboxamide |
| SMILES | Cc1cc(C)cc(-c2ccc(CC(=O)N[C@@H]3CCC[C@@H]3C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-14-10-15(2)12-18(11-14)17-8-6-16(7-9-17)13-21(25)23-20-5-3-4-19(20)22(26)24-27/h6-12,19-20,27H,3-5,13H2,1-2H3,(H,23,25)(H,24,26)/t19-,20+/m0/s1 |
| InChIKey | BEZZBOOYPLAKSE-VQTJNVASSA-N |
| XLogP | 3.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|