C33H30F3N3O8 — CID 139969314
[[3-[2-(hydroxyamino)-2-oxoethyl]-5-(4-methoxyphenyl)oxolan-3-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139969314) has the molecular formula C33H30F3N3O8 and a molecular weight of 653.61 g/mol. Its IUPAC name is [[3-[2-(hydroxyamino)-2-oxoethyl]-5-(4-methoxyphenyl)oxolan-3-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[2-(hydroxyamino)-2-oxoethyl]-5-(4-methoxyphenyl)oxolan-3-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139969314 |
| Molecular Formula | C33H30F3N3O8 |
| Molecular Weight | 653.61 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | [[3-[2-(hydroxyamino)-2-oxoethyl]-5-(4-methoxyphenyl)oxolan-3-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(C2CC(CC(=O)NO)(N(OC(=O)C(F)(F)F)C(=O)c3ccc(OCc4cc(C)nc5ccccc45)cc3)CO2)cc1 |
| InChI | InChI=1S/C33H30F3N3O8/c1-20-15-23(26-5-3-4-6-27(26)37-20)18-45-25-13-9-22(10-14-25)30(41)39(47-31(42)33(34,35)36)32(17-29(40)38-43)16-28(46-19-32)21-7-11-24(44-2)12-8-21/h3-15,28,43H,16-19H2,1-2H3,(H,38,40) |
| InChIKey | BTSSTMAQIRNFIR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|