C19H9F16KO3S — CID 139969512
potassium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)naphthalene-1-sulfonate (PubChem CID 139969512) has the molecular formula C19H9F16KO3S and a molecular weight of 660.41 g/mol. Its IUPAC name is potassium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)naphthalene-1-sulfonate.
| Compound Name | potassium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 139969512 |
| Molecular Formula | C19H9F16KO3S |
| Molecular Weight | 660.41 g/mol |
| Exact Mass | 659.97 |
| IUPAC Name | potassium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)naphthalene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1cccc2c(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cccc12.[K+] |
| InChI | InChI=1S/C19H10F16O3S.K/c20-12(21)14(24,25)16(28,29)18(32,33)19(34,35)17(30,31)15(26,27)13(22,23)7-8-3-1-5-10-9(8)4-2-6-11(10)39(36,37)38;/h1-6,12H,7H2,(H,36,37,38);/q;+1/p-1 |
| InChIKey | QDEURULTCAJJHA-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|