C26H33N3O5S — CID 139969846
N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-2-[(2S)-4-methoxyimino-1-(4-phenylphenyl)sulfonylpyrrolidin-2-yl]acetamide (PubChem CID 139969846) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-2-[(2S)-4-methoxyimino-1-(4-phenylphenyl)sulfonylpyrrolidin-2-yl]acetamide.
| Compound Name | N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-2-[(2S)-4-methoxyimino-1-(4-phenylphenyl)sulfonylpyrrolidin-2-yl]acetamide |
|---|---|
| PubChem CID | 139969846 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]-2-[(2S)-4-methoxyimino-1-(4-phenylphenyl)sulfonylpyrrolidin-2-yl]acetamide |
| SMILES | CON=C1C[C@@H](CC(=O)N[C@@H]2CCCC[C@H]2CO)N(S(=O)(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C26H33N3O5S/c1-34-28-22-15-23(16-26(31)27-25-10-6-5-9-21(25)18-30)29(17-22)35(32,33)24-13-11-20(12-14-24)19-7-3-2-4-8-19/h2-4,7-8,11-14,21,23,25,30H,5-6,9-10,15-18H2,1H3,(H,27,31)/t21-,23-,25+/m0/s1 |
| InChIKey | YHLZKEWJWQOVOV-UMXIMWEHSA-N |
| XLogP | 3.18 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|