C18H9F14NaO3S — CID 139970154
sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctyl)naphthalene-2-sulfonate (PubChem CID 139970154) has the molecular formula C18H9F14NaO3S and a molecular weight of 594.30 g/mol. Its IUPAC name is sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctyl)naphthalene-2-sulfonate.
| Compound Name | sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctyl)naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 139970154 |
| Molecular Formula | C18H9F14NaO3S |
| Molecular Weight | 594.30 g/mol |
| Exact Mass | 593.99 |
| IUPAC Name | sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctyl)naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cccc2c1.[Na+] |
| InChI | InChI=1S/C18H10F14O3S.Na/c19-12(20)14(23,24)16(27,28)18(31,32)17(29,30)15(25,26)13(21,22)7-9-3-1-2-8-6-10(36(33,34)35)4-5-11(8)9;/h1-6,12H,7H2,(H,33,34,35);/q;+1/p-1 |
| InChIKey | JCEFFKJIEJRPDD-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|