C21H19N3O2S — CID 139970353
4-[(E)-2-[4-(3-imidazol-1-ylpropoxy)phenyl]ethenyl]-2-thiophen-2-yl-1,3-oxazole (PubChem CID 139970353) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-[(E)-2-[4-(3-imidazol-1-ylpropoxy)phenyl]ethenyl]-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-[(E)-2-[4-(3-imidazol-1-ylpropoxy)phenyl]ethenyl]-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 139970353 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-[(E)-2-[4-(3-imidazol-1-ylpropoxy)phenyl]ethenyl]-2-thiophen-2-yl-1,3-oxazole |
| SMILES | C(=C/c1coc(-c2cccs2)n1)\c1ccc(OCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C21H19N3O2S/c1-3-20(27-14-1)21-23-18(15-26-21)7-4-17-5-8-19(9-6-17)25-13-2-11-24-12-10-22-16-24/h1,3-10,12,14-16H,2,11,13H2/b7-4+ |
| InChIKey | QMEKWVGKCPNURN-QPJJXVBHSA-N |
| XLogP | 5.24 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|