About 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol
2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol (PubChem CID 139971034) has the molecular formula C24H22N2O4
and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol.
Molecular Properties
| Compound Name | 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol |
| PubChem CID | 139971034 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol |
| SMILES | Nc1ccc(OC2C=CC=CC2(Oc2ccc(N)c(O)c2)c2ccccc2)cc1O |
| InChI | InChI=1S/C24H22N2O4/c25-19-11-9-17(14-21(19)27)29-23-8-4-5-13-24(23,16-6-2-1-3-7-16)30-18-10-12-20(26)22(28)15-18/h1-15,23,27-28H,25-26H2 |
| InChIKey | FWVVOEUQDBIYKR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol?
The IUPAC name of 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol (CID 139971034) is 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol.
What is the SMILES notation for 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol?
The canonical SMILES for 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol is Nc1ccc(OC2C=CC=CC2(Oc2ccc(N)c(O)c2)c2ccccc2)cc1O.
What is the InChIKey of 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol?
The InChIKey is FWVVOEUQDBIYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O4/c25-19-11-9-17(14-21(19)27)29-23-8-4-5-13-24(23,16-6-2-1-3-7-16)30-18-10-12-20(26)22(28)15-18/h1-15,23,27-28H,25-26H2.
What are the key properties of 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol?
2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol has a molecular weight of 402.45 g/mol, XLogP of 4.11, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[6-(4-amino-3-hydroxyphenoxy)-6-phenylcyclohexa-2,4-dien-1-yl]oxyphenol is sourced from PubChem (CID 139971034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).