C19H16F8N2O4 — CID 139971359
2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-1,2,3,3,4,4,5,5-octafluorocycloheptyl]oxyphenol (PubChem CID 139971359) has the molecular formula C19H16F8N2O4 and a molecular weight of 488.33 g/mol. Its IUPAC name is 2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-1,2,3,3,4,4,5,5-octafluorocycloheptyl]oxyphenol.
| Compound Name | 2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-1,2,3,3,4,4,5,5-octafluorocycloheptyl]oxyphenol |
|---|---|
| PubChem CID | 139971359 |
| Molecular Formula | C19H16F8N2O4 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-1,2,3,3,4,4,5,5-octafluorocycloheptyl]oxyphenol |
| SMILES | Nc1ccc(OC2(F)CCC(F)(F)C(F)(F)C(F)(F)C2(F)Oc2ccc(N)c(O)c2)cc1O |
| InChI | InChI=1S/C19H16F8N2O4/c20-15(21)5-6-16(22,32-9-1-3-11(28)13(30)7-9)19(27,18(25,26)17(15,23)24)33-10-2-4-12(29)14(31)8-10/h1-4,7-8,30-31H,5-6,28-29H2 |
| InChIKey | QANQQOAEBYEAFK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|