C26H29N3O6S — CID 139971959
N-[(2S)-4-methyl-1-oxo-1-(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 139971959) has the molecular formula C26H29N3O6S and a molecular weight of 511.60 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-oxo-1-(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S)-4-methyl-1-oxo-1-(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 139971959 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | N-[(2S)-4-methyl-1-oxo-1-(3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl)pentan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc2ccccc2o1)C(=O)C1CCCN(S(=O)(=O)c2ccccn2)CC1=O |
| InChI | InChI=1S/C26H29N3O6S/c1-17(2)14-20(28-26(32)23-15-18-8-3-4-10-22(18)35-23)25(31)19-9-7-13-29(16-21(19)30)36(33,34)24-11-5-6-12-27-24/h3-6,8,10-12,15,17,19-20H,7,9,13-14,16H2,1-2H3,(H,28,32)/t19?,20-/m0/s1 |
| InChIKey | DLMAFXMQGBWPSV-ANYOKISRSA-N |
| XLogP | 3.21 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|