C31H27ClN2O3 — CID 139972196
3'-(butylamino)-7'-(2-chloroanilino)-2'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139972196) has the molecular formula C31H27ClN2O3 and a molecular weight of 511.02 g/mol. Its IUPAC name is 3'-(butylamino)-7'-(2-chloroanilino)-2'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-(butylamino)-7'-(2-chloroanilino)-2'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139972196 |
| Molecular Formula | C31H27ClN2O3 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 3'-(butylamino)-7'-(2-chloroanilino)-2'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCNc1cc2c(cc1C)C1(OC(=O)c3ccccc31)c1cc(Nc3ccccc3Cl)ccc1O2 |
| InChI | InChI=1S/C31H27ClN2O3/c1-3-4-15-33-27-18-29-23(16-19(27)2)31(22-10-6-5-9-21(22)30(35)37-31)24-17-20(13-14-28(24)36-29)34-26-12-8-7-11-25(26)32/h5-14,16-18,33-34H,3-4,15H2,1-2H3 |
| InChIKey | YTACVOCTCFSIAU-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|