C9H14N2O3S2 — CID 139973006
1,3-bis(2-sulfanylpropyl)imidazolidine-2,4,5-trione (PubChem CID 139973006) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 1,3-bis(2-sulfanylpropyl)imidazolidine-2,4,5-trione.
| Compound Name | 1,3-bis(2-sulfanylpropyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 139973006 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1,3-bis(2-sulfanylpropyl)imidazolidine-2,4,5-trione |
| SMILES | CC(S)CN1C(=O)C(=O)N(CC(C)S)C1=O |
| InChI | InChI=1S/C9H14N2O3S2/c1-5(15)3-10-7(12)8(13)11(9(10)14)4-6(2)16/h5-6,15-16H,3-4H2,1-2H3 |
| InChIKey | LYMXEHGUQPUNFX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|