C9H16N4O5 — CID 139973010
1,3-bis(3-amino-2-hydroxypropyl)imidazolidine-2,4,5-trione (PubChem CID 139973010) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1,3-bis(3-amino-2-hydroxypropyl)imidazolidine-2,4,5-trione.
| Compound Name | 1,3-bis(3-amino-2-hydroxypropyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 139973010 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1,3-bis(3-amino-2-hydroxypropyl)imidazolidine-2,4,5-trione |
| SMILES | NCC(O)CN1C(=O)C(=O)N(CC(O)CN)C1=O |
| InChI | InChI=1S/C9H16N4O5/c10-1-5(14)3-12-7(16)8(17)13(9(12)18)4-6(15)2-11/h5-6,14-15H,1-4,10-11H2 |
| InChIKey | OUOUNKPUBLUGHD-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 150.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|