About 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate
2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate (PubChem CID 139973078) has the molecular formula C13H28N4O4S
and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate |
| PubChem CID | 139973078 |
| Molecular Formula | C13H28N4O4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNCCNCCNCCNS(C)(=O)=O |
| InChI | InChI=1S/C13H28N4O4S/c1-12(2)13(18)21-11-10-16-7-6-14-4-5-15-8-9-17-22(3,19)20/h14-17H,1,4-11H2,2-3H3 |
| InChIKey | SMQCFAJQWSICQP-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate?
The IUPAC name of 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate (CID 139973078) is 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate?
The canonical SMILES for 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCNCCNCCNCCNS(C)(=O)=O.
What is the InChIKey of 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate?
The InChIKey is SMQCFAJQWSICQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N4O4S/c1-12(2)13(18)21-11-10-16-7-6-14-4-5-15-8-9-17-22(3,19)20/h14-17H,1,4-11H2,2-3H3.
What are the key properties of 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate?
2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate has a molecular weight of 336.46 g/mol, XLogP of -1.58, 14 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 139973078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).