C10H14FNO2 — CID 139973193
3-ethyl-4-(1-fluorobutyl)pyrrole-2,5-dione (PubChem CID 139973193) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is 3-ethyl-4-(1-fluorobutyl)pyrrole-2,5-dione.
| Compound Name | 3-ethyl-4-(1-fluorobutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139973193 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-ethyl-4-(1-fluorobutyl)pyrrole-2,5-dione |
| SMILES | CCCC(F)C1=C(CC)C(=O)NC1=O |
| InChI | InChI=1S/C10H14FNO2/c1-3-5-7(11)8-6(4-2)9(13)12-10(8)14/h7H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | IHEYNSKQQBLWIF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|