About 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene
5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene (PubChem CID 139973452) has the molecular formula C16H12Br2F4O3
and a molecular weight of 488.07 g/mol. Its IUPAC name is 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene |
| PubChem CID | 139973452 |
| Molecular Formula | C16H12Br2F4O3 |
| Molecular Weight | 488.07 g/mol |
| Exact Mass | 485.91 |
| IUPAC Name | 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene |
| SMILES | Fc1cc(Br)cc(F)c1COCOCOCc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C16H12Br2F4O3/c17-9-1-13(19)11(14(20)2-9)5-23-7-25-8-24-6-12-15(21)3-10(18)4-16(12)22/h1-4H,5-8H2 |
| InChIKey | VSXFQBBGJGKGFR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.07 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene?
The IUPAC name of 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene (CID 139973452) is 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene.
What is the SMILES notation for 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene?
The canonical SMILES for 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene is Fc1cc(Br)cc(F)c1COCOCOCc1c(F)cc(Br)cc1F.
What is the InChIKey of 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene?
The InChIKey is VSXFQBBGJGKGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Br2F4O3/c17-9-1-13(19)11(14(20)2-9)5-23-7-25-8-24-6-12-15(21)3-10(18)4-16(12)22/h1-4H,5-8H2.
What are the key properties of 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene?
5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene has a molecular weight of 488.07 g/mol, XLogP of 5.43, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(4-bromo-2,6-difluorophenyl)methoxymethoxymethoxymethyl]-1,3-difluorobenzene is sourced from PubChem (CID 139973452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).