About 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate
1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate (PubChem CID 139973962) has the molecular formula C16H26N2O5Si
and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate.
Molecular Properties
| Compound Name | 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate |
| PubChem CID | 139973962 |
| Molecular Formula | C16H26N2O5Si |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate |
| SMILES | CCO[Si](C)(C)CCCNC(=O)OC(C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H26N2O5Si/c1-5-22-24(3,4)12-8-11-17-16(19)23-13(2)14-9-6-7-10-15(14)18(20)21/h6-7,9-10,13H,5,8,11-12H2,1-4H3,(H,17,19) |
| InChIKey | XPHCUWDCZCSOMC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate?
The IUPAC name of 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate (CID 139973962) is 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate.
What is the SMILES notation for 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate?
The canonical SMILES for 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate is CCO[Si](C)(C)CCCNC(=O)OC(C)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate?
The InChIKey is XPHCUWDCZCSOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O5Si/c1-5-22-24(3,4)12-8-11-17-16(19)23-13(2)14-9-6-7-10-15(14)18(20)21/h6-7,9-10,13H,5,8,11-12H2,1-4H3,(H,17,19).
What are the key properties of 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate?
1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate has a molecular weight of 354.48 g/mol, XLogP of 4.01, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-nitrophenyl)ethyl N-[3-[ethoxy(dimethyl)silyl]propyl]carbamate is sourced from PubChem (CID 139973962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).