About (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole (PubChem CID 139974133) has the molecular formula C20H25N3
and a molecular weight of 307.44 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole.
Molecular Properties
| Compound Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole |
| PubChem CID | 139974133 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole |
| SMILES | Cc1cc(C)c(/C=C2\CN(CN3CCCC3)c3ccccc32)[nH]1 |
| InChI | InChI=1S/C20H25N3/c1-15-11-16(2)21-19(15)12-17-13-23(14-22-9-5-6-10-22)20-8-4-3-7-18(17)20/h3-4,7-8,11-12,21H,5-6,9-10,13-14H2,1-2H3/b17-12+ |
| InChIKey | YHHUQWQQBHDGDY-SFQUDFHCSA-N |
| XLogP | 4.05 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole?
The IUPAC name of (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole (CID 139974133) is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole.
What is the SMILES notation for (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole?
The canonical SMILES for (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole is Cc1cc(C)c(/C=C2\CN(CN3CCCC3)c3ccccc32)[nH]1.
What is the InChIKey of (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole?
The InChIKey is YHHUQWQQBHDGDY-SFQUDFHCSA-N. The full InChI is InChI=1S/C20H25N3/c1-15-11-16(2)21-19(15)12-17-13-23(14-22-9-5-6-10-22)20-8-4-3-7-18(17)20/h3-4,7-8,11-12,21H,5-6,9-10,13-14H2,1-2H3/b17-12+.
What are the key properties of (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole?
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole has a molecular weight of 307.44 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(pyrrolidin-1-ylmethyl)-2H-indole is sourced from PubChem (CID 139974133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).