About 1-but-2-en-2-yloxydecane
1-but-2-en-2-yloxydecane (PubChem CID 139974507) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-but-2-en-2-yloxydecane.
Molecular Properties
| Compound Name | 1-but-2-en-2-yloxydecane |
| PubChem CID | 139974507 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 1-but-2-en-2-yloxydecane |
| SMILES | CC=C(C)OCCCCCCCCCC |
| InChI | InChI=1S/C14H28O/c1-4-6-7-8-9-10-11-12-13-15-14(3)5-2/h5H,4,6-13H2,1-3H3 |
| InChIKey | VUOYCBOYCNKXRO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-but-2-en-2-yloxydecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-en-2-yloxydecane?
The IUPAC name of 1-but-2-en-2-yloxydecane (CID 139974507) is 1-but-2-en-2-yloxydecane.
What is the SMILES notation for 1-but-2-en-2-yloxydecane?
The canonical SMILES for 1-but-2-en-2-yloxydecane is CC=C(C)OCCCCCCCCCC.
What is the InChIKey of 1-but-2-en-2-yloxydecane?
The InChIKey is VUOYCBOYCNKXRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-4-6-7-8-9-10-11-12-13-15-14(3)5-2/h5H,4,6-13H2,1-3H3.
What are the key properties of 1-but-2-en-2-yloxydecane?
1-but-2-en-2-yloxydecane has a molecular weight of 212.38 g/mol, XLogP of 5.07, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-en-2-yloxydecane is sourced from PubChem (CID 139974507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).