About 1-but-2-en-2-yloxyoctane
1-but-2-en-2-yloxyoctane (PubChem CID 139974518) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 1-but-2-en-2-yloxyoctane.
Molecular Properties
| Compound Name | 1-but-2-en-2-yloxyoctane |
| PubChem CID | 139974518 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 1-but-2-en-2-yloxyoctane |
| SMILES | CC=C(C)OCCCCCCCC |
| InChI | InChI=1S/C12H24O/c1-4-6-7-8-9-10-11-13-12(3)5-2/h5H,4,6-11H2,1-3H3 |
| InChIKey | OQIZNFHFPVYXPF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-but-2-en-2-yloxyoctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-en-2-yloxyoctane?
The IUPAC name of 1-but-2-en-2-yloxyoctane (CID 139974518) is 1-but-2-en-2-yloxyoctane.
What is the SMILES notation for 1-but-2-en-2-yloxyoctane?
The canonical SMILES for 1-but-2-en-2-yloxyoctane is CC=C(C)OCCCCCCCC.
What is the InChIKey of 1-but-2-en-2-yloxyoctane?
The InChIKey is OQIZNFHFPVYXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-4-6-7-8-9-10-11-13-12(3)5-2/h5H,4,6-11H2,1-3H3.
What are the key properties of 1-but-2-en-2-yloxyoctane?
1-but-2-en-2-yloxyoctane has a molecular weight of 184.32 g/mol, XLogP of 4.29, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-en-2-yloxyoctane is sourced from PubChem (CID 139974518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).