C18H8Cl10O3 — CID 139974552
2-[[oxiran-2-yl-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxirane (PubChem CID 139974552) has the molecular formula C18H8Cl10O3 and a molecular weight of 626.79 g/mol. Its IUPAC name is 2-[[oxiran-2-yl-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxirane.
| Compound Name | 2-[[oxiran-2-yl-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxirane |
|---|---|
| PubChem CID | 139974552 |
| Molecular Formula | C18H8Cl10O3 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 621.74 |
| IUPAC Name | 2-[[oxiran-2-yl-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxirane |
| SMILES | Clc1c(Cl)c(Cl)c(C(OC(c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)C2CO2)C2CO2)c(Cl)c1Cl |
| InChI | InChI=1S/C18H8Cl10O3/c19-7-5(8(20)12(24)15(27)11(7)23)17(3-1-29-3)31-18(4-2-30-4)6-9(21)13(25)16(28)14(26)10(6)22/h3-4,17-18H,1-2H2 |
| InChIKey | VBMCMAUHMVBLKR-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|