C20H26F4O4S2 — CID 139974563
(2-oxocyclohexyl)sulfanyl 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate (PubChem CID 139974563) has the molecular formula C20H26F4O4S2 and a molecular weight of 470.55 g/mol. Its IUPAC name is (2-oxocyclohexyl)sulfanyl 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate.
| Compound Name | (2-oxocyclohexyl)sulfanyl 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
|---|---|
| PubChem CID | 139974563 |
| Molecular Formula | C20H26F4O4S2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (2-oxocyclohexyl)sulfanyl 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
| SMILES | O=C1CCCCC1SOS(=O)(=O)C(F)(F)C(F)(F)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C20H26F4O4S2/c21-19(22,14-9-12-8-13(14)18-11-6-5-10(7-11)17(12)18)20(23,24)30(26,27)28-29-16-4-2-1-3-15(16)25/h10-14,16-18H,1-9H2 |
| InChIKey | XYXLTBWPXUICDZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|