C27H34F4O5S2 — CID 139974584
[1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate (PubChem CID 139974584) has the molecular formula C27H34F4O5S2 and a molecular weight of 578.69 g/mol. Its IUPAC name is [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate.
| Compound Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate |
|---|---|
| PubChem CID | 139974584 |
| Molecular Formula | C27H34F4O5S2 |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate |
| SMILES | CCCCOc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C3CC4CC3CC4O)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C27H34F4O5S2/c1-2-3-12-35-24-10-11-25(21-9-5-4-8-20(21)24)37(13-6-7-14-37)36-38(33,34)27(30,31)26(28,29)22-16-19-15-18(22)17-23(19)32/h4-5,8-11,18-19,22-23,32H,2-3,6-7,12-17H2,1H3 |
| InChIKey | WPALTCAJUSMAAW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|