C36H30N3O6P3 — CID 139975539
4-[2,4,4,6,6-pentakis(4-hydroxyphenyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]phenol (PubChem CID 139975539) has the molecular formula C36H30N3O6P3 and a molecular weight of 693.57 g/mol. Its IUPAC name is 4-[2,4,4,6,6-pentakis(4-hydroxyphenyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]phenol.
| Compound Name | 4-[2,4,4,6,6-pentakis(4-hydroxyphenyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]phenol |
|---|---|
| PubChem CID | 139975539 |
| Molecular Formula | C36H30N3O6P3 |
| Molecular Weight | 693.57 g/mol |
| Exact Mass | 693.13 |
| IUPAC Name | 4-[2,4,4,6,6-pentakis(4-hydroxyphenyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]phenol |
| SMILES | Oc1ccc(P2(c3ccc(O)cc3)=NP(c3ccc(O)cc3)(c3ccc(O)cc3)=NP(c3ccc(O)cc3)(c3ccc(O)cc3)=N2)cc1 |
| InChI | InChI=1S/C36H30N3O6P3/c40-25-1-13-31(14-2-25)46(32-15-3-26(41)4-16-32)37-47(33-17-5-27(42)6-18-33,34-19-7-28(43)8-20-34)39-48(38-46,35-21-9-29(44)10-22-35)36-23-11-30(45)12-24-36/h1-24,40-45H |
| InChIKey | HZMHAFDUEGEZHC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|