C26H26F2N2O7 — CID 139975980
9-[3-[bis(4-fluorophenyl)methoxy]propyl]-14-methyl-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione (PubChem CID 139975980) has the molecular formula C26H26F2N2O7 and a molecular weight of 516.50 g/mol. Its IUPAC name is 9-[3-[bis(4-fluorophenyl)methoxy]propyl]-14-methyl-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione.
| Compound Name | 9-[3-[bis(4-fluorophenyl)methoxy]propyl]-14-methyl-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione |
|---|---|
| PubChem CID | 139975980 |
| Molecular Formula | C26H26F2N2O7 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 9-[3-[bis(4-fluorophenyl)methoxy]propyl]-14-methyl-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione |
| SMILES | CN1C(=O)OC2(CCN(CCCOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)C12OC(=O)C(=O)O2 |
| InChI | InChI=1S/C26H26F2N2O7/c1-29-24(33)37-25(26(29)35-22(31)23(32)36-26)11-14-30(15-12-25)13-2-16-34-21(17-3-7-19(27)8-4-17)18-5-9-20(28)10-6-18/h3-10,21H,2,11-16H2,1H3 |
| InChIKey | ZWOOUJXBPDQQDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|