C25H22F3N9S — CID 139976260
4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-[3-(trifluoromethylsulfanyl)phenyl]pyrimidine-2,4,6-triamine (PubChem CID 139976260) has the molecular formula C25H22F3N9S and a molecular weight of 537.58 g/mol. Its IUPAC name is 4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-[3-(trifluoromethylsulfanyl)phenyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-[3-(trifluoromethylsulfanyl)phenyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976260 |
| Molecular Formula | C25H22F3N9S |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-[3-(trifluoromethylsulfanyl)phenyl]pyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccncc2)nc(Nc2cccc(SC(F)(F)F)c2)n1)c1ccncc1 |
| InChI | InChI=1S/C25H22F3N9S/c1-16(18-6-10-29-11-7-18)34-36-22-15-23(37-35-17(2)19-8-12-30-13-9-19)33-24(32-22)31-20-4-3-5-21(14-20)38-25(26,27)28/h3-15H,1-2H3,(H3,31,32,33,36,37) |
| InChIKey | DOZLUGZAFIOFJR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|