C35H35N7O4S2 — CID 139976267
5-benzyl-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976267) has the molecular formula C35H35N7O4S2 and a molecular weight of 681.84 g/mol. Its IUPAC name is 5-benzyl-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 5-benzyl-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976267 |
| Molecular Formula | C35H35N7O4S2 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.22 |
| IUPAC Name | 5-benzyl-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1nc(Nc2ccccc2)nc(NN=C(C)c2ccc(S(C)(=O)=O)cc2)c1Cc1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C35H35N7O4S2/c1-24(27-15-19-30(20-16-27)47(3,43)44)39-41-33-32(23-26-11-7-5-8-12-26)34(38-35(37-33)36-29-13-9-6-10-14-29)42-40-25(2)28-17-21-31(22-18-28)48(4,45)46/h5-22H,23H2,1-4H3,(H3,36,37,38,41,42) |
| InChIKey | KWFAMBYQJMEXHK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 154.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|