C24H20F3N9 — CID 139976482
4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine (PubChem CID 139976482) has the molecular formula C24H20F3N9 and a molecular weight of 491.48 g/mol. Its IUPAC name is 4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976482 |
| Molecular Formula | C24H20F3N9 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 4-N,6-N-bis(1-pyridin-4-ylethylideneamino)-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccncc2)nc(Nc2ccc(F)c(F)c2F)n1)c1ccncc1 |
| InChI | InChI=1S/C24H20F3N9/c1-14(16-5-9-28-10-6-16)33-35-20-13-21(36-34-15(2)17-7-11-29-12-8-17)32-24(31-20)30-19-4-3-18(25)22(26)23(19)27/h3-13H,1-2H3,(H3,30,31,32,35,36) |
| InChIKey | OFSVBEMFZZZHPE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|