C17H34O — CID 139977052
5,7-diethyl-4,8-dimethylundecan-6-one (PubChem CID 139977052) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is 5,7-diethyl-4,8-dimethylundecan-6-one.
| Compound Name | 5,7-diethyl-4,8-dimethylundecan-6-one |
|---|---|
| PubChem CID | 139977052 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 5,7-diethyl-4,8-dimethylundecan-6-one |
| SMILES | CCCC(C)C(CC)C(=O)C(CC)C(C)CCC |
| InChI | InChI=1S/C17H34O/c1-7-11-13(5)15(9-3)17(18)16(10-4)14(6)12-8-2/h13-16H,7-12H2,1-6H3 |
| InChIKey | UQWSWTMQDQXTJO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |