About 1,4-diethyl-3,5-dipropylpyrazolidine
1,4-diethyl-3,5-dipropylpyrazolidine (PubChem CID 139977646) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1,4-diethyl-3,5-dipropylpyrazolidine.
Molecular Properties
| Compound Name | 1,4-diethyl-3,5-dipropylpyrazolidine |
| PubChem CID | 139977646 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1,4-diethyl-3,5-dipropylpyrazolidine |
| SMILES | CCCC1NN(CC)C(CCC)C1CC |
| InChI | InChI=1S/C13H28N2/c1-5-9-12-11(7-3)13(10-6-2)15(8-4)14-12/h11-14H,5-10H2,1-4H3 |
| InChIKey | ZMHSDPMGAMZJNN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-diethyl-3,5-dipropylpyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethyl-3,5-dipropylpyrazolidine?
The IUPAC name of 1,4-diethyl-3,5-dipropylpyrazolidine (CID 139977646) is 1,4-diethyl-3,5-dipropylpyrazolidine.
What is the SMILES notation for 1,4-diethyl-3,5-dipropylpyrazolidine?
The canonical SMILES for 1,4-diethyl-3,5-dipropylpyrazolidine is CCCC1NN(CC)C(CCC)C1CC.
What is the InChIKey of 1,4-diethyl-3,5-dipropylpyrazolidine?
The InChIKey is ZMHSDPMGAMZJNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-5-9-12-11(7-3)13(10-6-2)15(8-4)14-12/h11-14H,5-10H2,1-4H3.
What are the key properties of 1,4-diethyl-3,5-dipropylpyrazolidine?
1,4-diethyl-3,5-dipropylpyrazolidine has a molecular weight of 212.38 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethyl-3,5-dipropylpyrazolidine is sourced from PubChem (CID 139977646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).