About methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate
methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate (PubChem CID 139978144) has the molecular formula C22H15BrCl2FNO4
and a molecular weight of 527.17 g/mol. Its IUPAC name is methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate |
| PubChem CID | 139978144 |
| Molecular Formula | C22H15BrCl2FNO4 |
| Molecular Weight | 527.17 g/mol |
| Exact Mass | 524.95 |
| IUPAC Name | methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate |
| SMILES | COC(=O)Cc1cc(Cl)c(Oc2ccc(NC(=O)c3ccc(F)cc3)c(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H15BrCl2FNO4/c1-30-20(28)10-12-8-17(24)21(18(25)9-12)31-15-6-7-19(16(23)11-15)27-22(29)13-2-4-14(26)5-3-13/h2-9,11H,10H2,1H3,(H,27,29) |
| InChIKey | AXUVREBPSXQHPC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.17 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate?
The IUPAC name of methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate (CID 139978144) is methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate.
What is the SMILES notation for methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate?
The canonical SMILES for methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate is COC(=O)Cc1cc(Cl)c(Oc2ccc(NC(=O)c3ccc(F)cc3)c(Br)c2)c(Cl)c1.
What is the InChIKey of methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate?
The InChIKey is AXUVREBPSXQHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrCl2FNO4/c1-30-20(28)10-12-8-17(24)21(18(25)9-12)31-15-6-7-19(16(23)11-15)27-22(29)13-2-4-14(26)5-3-13/h2-9,11H,10H2,1H3,(H,27,29).
What are the key properties of methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate?
methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate has a molecular weight of 527.17 g/mol, XLogP of 6.66, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[3-bromo-4-[(4-fluorobenzoyl)amino]phenoxy]-3,5-dichlorophenyl]acetate is sourced from PubChem (CID 139978144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).