About 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde
2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde (PubChem CID 139979650) has the molecular formula C12H7FN4O2
and a molecular weight of 258.21 g/mol. Its IUPAC name is 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde.
Molecular Properties
| Compound Name | 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde |
| PubChem CID | 139979650 |
| Molecular Formula | C12H7FN4O2 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)c1c[nH]c2c(-c3ncn[nH]3)ccc(F)c12 |
| InChI | InChI=1S/C12H7FN4O2/c13-8-2-1-6(12-15-5-16-17-12)11-10(8)7(3-14-11)9(19)4-18/h1-5,14H,(H,15,16,17) |
| InChIKey | PRYBPKVKAQGZNS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde?
The IUPAC name of 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde (CID 139979650) is 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde.
What is the SMILES notation for 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde?
The canonical SMILES for 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde is O=CC(=O)c1c[nH]c2c(-c3ncn[nH]3)ccc(F)c12.
What is the InChIKey of 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde?
The InChIKey is PRYBPKVKAQGZNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7FN4O2/c13-8-2-1-6(12-15-5-16-17-12)11-10(8)7(3-14-11)9(19)4-18/h1-5,14H,(H,15,16,17).
What are the key properties of 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde?
2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde has a molecular weight of 258.21 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-fluoro-7-(1H-1,2,4-triazol-5-yl)-1H-indol-3-yl]-2-oxoacetaldehyde is sourced from PubChem (CID 139979650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).