About 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide
2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide (PubChem CID 139979752) has the molecular formula C9H8N4O2
and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide |
| PubChem CID | 139979752 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide |
| SMILES | NC(=O)Cc1cnc2cnccn2c1=O |
| InChI | InChI=1S/C9H8N4O2/c10-7(14)3-6-4-12-8-5-11-1-2-13(8)9(6)15/h1-2,4-5H,3H2,(H2,10,14) |
| InChIKey | VLYAWCXJDLVEQL-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide?
The IUPAC name of 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide (CID 139979752) is 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide.
What is the SMILES notation for 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide?
The canonical SMILES for 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide is NC(=O)Cc1cnc2cnccn2c1=O.
What is the InChIKey of 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide?
The InChIKey is VLYAWCXJDLVEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2/c10-7(14)3-6-4-12-8-5-11-1-2-13(8)9(6)15/h1-2,4-5H,3H2,(H2,10,14).
What are the key properties of 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide?
2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide has a molecular weight of 204.19 g/mol, XLogP of -0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-oxopyrazino[1,2-a]pyrimidin-3-yl)acetamide is sourced from PubChem (CID 139979752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).