C25H26F2N2O2S — CID 139981213
2-naphthalen-2-ylethyl (2S,4R)-2-[[(2,5-difluorophenyl)methylamino]methyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 139981213) has the molecular formula C25H26F2N2O2S and a molecular weight of 456.56 g/mol. Its IUPAC name is 2-naphthalen-2-ylethyl (2S,4R)-2-[[(2,5-difluorophenyl)methylamino]methyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | 2-naphthalen-2-ylethyl (2S,4R)-2-[[(2,5-difluorophenyl)methylamino]methyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139981213 |
| Molecular Formula | C25H26F2N2O2S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-naphthalen-2-ylethyl (2S,4R)-2-[[(2,5-difluorophenyl)methylamino]methyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | O=C(OCCc1ccc2ccccc2c1)N1C[C@H](S)C[C@H]1CNCc1cc(F)ccc1F |
| InChI | InChI=1S/C25H26F2N2O2S/c26-21-7-8-24(27)20(12-21)14-28-15-22-13-23(32)16-29(22)25(30)31-10-9-17-5-6-18-3-1-2-4-19(18)11-17/h1-8,11-12,22-23,28,32H,9-10,13-16H2/t22-,23+/m0/s1 |
| InChIKey | AWMCRBDPFHFGEU-XZOQPEGZSA-N |
| XLogP | 4.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|