About 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one
5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one (PubChem CID 139981398) has the molecular formula C25H31N3O2
and a molecular weight of 405.54 g/mol. Its IUPAC name is 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one |
| PubChem CID | 139981398 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(CCCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)[nH][nH]1 |
| InChI | InChI=1S/C25H31N3O2/c29-24-19-22(26-27-24)13-7-8-16-28-17-14-23(15-18-28)30-25(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-6,9-12,19,23,25H,7-8,13-18H2,(H2,26,27,29) |
| InChIKey | NZPQWMWFWKUDEN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one (CID 139981398) is 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one is O=c1cc(CCCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)[nH][nH]1.
What is the InChIKey of 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one?
The InChIKey is NZPQWMWFWKUDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3O2/c29-24-19-22(26-27-24)13-7-8-16-28-17-14-23(15-18-28)30-25(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-6,9-12,19,23,25H,7-8,13-18H2,(H2,26,27,29).
What are the key properties of 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one?
5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one has a molecular weight of 405.54 g/mol, XLogP of 4.30, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 139981398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).