About (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol
(5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 139981442) has the molecular formula C14H8Cl2F3NO3
and a molecular weight of 366.12 g/mol. Its IUPAC name is (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol |
| PubChem CID | 139981442 |
| Molecular Formula | C14H8Cl2F3NO3 |
| Molecular Weight | 366.12 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | OC(c1c(C(F)(F)F)ccnc1Cl)c1c(Cl)ccc2c1OCO2 |
| InChI | InChI=1S/C14H8Cl2F3NO3/c15-7-1-2-8-12(23-5-22-8)10(7)11(21)9-6(14(17,18)19)3-4-20-13(9)16/h1-4,11,21H,5H2 |
| InChIKey | IWAFIVXIONLGKY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.12 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol?
The IUPAC name of (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol (CID 139981442) is (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol.
What is the SMILES notation for (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol?
The canonical SMILES for (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol is OC(c1c(C(F)(F)F)ccnc1Cl)c1c(Cl)ccc2c1OCO2.
What is the InChIKey of (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol?
The InChIKey is IWAFIVXIONLGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F3NO3/c15-7-1-2-8-12(23-5-22-8)10(7)11(21)9-6(14(17,18)19)3-4-20-13(9)16/h1-4,11,21H,5H2.
What are the key properties of (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol?
(5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol has a molecular weight of 366.12 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,3-benzodioxol-4-yl)-[2-chloro-4-(trifluoromethyl)-3-pyridinyl]methanol is sourced from PubChem (CID 139981442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).