C21H20O4 — CID 139981573
4-[2-(4-carboxy-3-ethenylphenyl)propan-2-yl]-2-ethenylbenzoic acid (PubChem CID 139981573) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[2-(4-carboxy-3-ethenylphenyl)propan-2-yl]-2-ethenylbenzoic acid.
| Compound Name | 4-[2-(4-carboxy-3-ethenylphenyl)propan-2-yl]-2-ethenylbenzoic acid |
|---|---|
| PubChem CID | 139981573 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[2-(4-carboxy-3-ethenylphenyl)propan-2-yl]-2-ethenylbenzoic acid |
| SMILES | C=Cc1cc(C(C)(C)c2ccc(C(=O)O)c(C=C)c2)ccc1C(=O)O |
| InChI | InChI=1S/C21H20O4/c1-5-13-11-15(7-9-17(13)19(22)23)21(3,4)16-8-10-18(20(24)25)14(6-2)12-16/h5-12H,1-2H2,3-4H3,(H,22,23)(H,24,25) |
| InChIKey | ISJMTJWTXHCFTG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |