About N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine
N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine (PubChem CID 139982953) has the molecular formula C21H37N3O
and a molecular weight of 347.55 g/mol. Its IUPAC name is N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine |
| PubChem CID | 139982953 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine |
| SMILES | CNCC1(C2CCNCC2)C=CC(OCCCN2CCCCC2)=CC1 |
| InChI | InChI=1S/C21H37N3O/c1-22-18-21(19-8-12-23-13-9-19)10-6-20(7-11-21)25-17-5-16-24-14-3-2-4-15-24/h6-7,10,19,22-23H,2-5,8-9,11-18H2,1H3 |
| InChIKey | YNLFCMXNBCCXCS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine?
The IUPAC name of N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine (CID 139982953) is N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine.
What is the SMILES notation for N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine?
The canonical SMILES for N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine is CNCC1(C2CCNCC2)C=CC(OCCCN2CCCCC2)=CC1.
What is the InChIKey of N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine?
The InChIKey is YNLFCMXNBCCXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37N3O/c1-22-18-21(19-8-12-23-13-9-19)10-6-20(7-11-21)25-17-5-16-24-14-3-2-4-15-24/h6-7,10,19,22-23H,2-5,8-9,11-18H2,1H3.
What are the key properties of N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine?
N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine has a molecular weight of 347.55 g/mol, XLogP of 2.93, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[1-piperidin-4-yl-4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methanamine is sourced from PubChem (CID 139982953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).