C19H24O4 — CID 139984113
(3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl) 2-methoxy-2-phenylacetate (PubChem CID 139984113) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl) 2-methoxy-2-phenylacetate.
| Compound Name | (3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl) 2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 139984113 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl) 2-methoxy-2-phenylacetate |
| SMILES | C=CCC12CCCC1(OC(=O)C(OC)c1ccccc1)OCC2 |
| InChI | InChI=1S/C19H24O4/c1-3-10-18-11-7-12-19(18,22-14-13-18)23-17(20)16(21-2)15-8-5-4-6-9-15/h3-6,8-9,16H,1,7,10-14H2,2H3 |
| InChIKey | OAUWUEYRWZQWDO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|