C15H23NO4 — CID 139984645
hexyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-methylbutanoate (PubChem CID 139984645) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is hexyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-methylbutanoate.
| Compound Name | hexyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 139984645 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | hexyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-methylbutanoate |
| SMILES | CCCCCCOC(=O)[C@H](C(C)C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H23NO4/c1-4-5-6-7-10-20-15(19)14(11(2)3)16-12(17)8-9-13(16)18/h8-9,11,14H,4-7,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | WQQPNINBKIOZPK-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|