C32H40N4O4 — CID 139984730
1-N-[(2S)-3-hydroxyimino-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 139984730) has the molecular formula C32H40N4O4 and a molecular weight of 544.70 g/mol. Its IUPAC name is 1-N-[(2S)-3-hydroxyimino-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S)-3-hydroxyimino-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139984730 |
| Molecular Formula | C32H40N4O4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | 1-N-[(2S)-3-hydroxyimino-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccccc2)C(CNCc2cccc(OC)c2)=NO)c1 |
| InChI | InChI=1S/C32H40N4O4/c1-4-17-36(18-5-2)32(38)27-15-10-14-26(21-27)31(37)34-29(20-24-11-7-6-8-12-24)30(35-39)23-33-22-25-13-9-16-28(19-25)40-3/h6-16,19,21,29,33,39H,4-5,17-18,20,22-23H2,1-3H3,(H,34,37)/t29-/m0/s1 |
| InChIKey | MWLWUWABCSAEKF-LJAQVGFWSA-N |
| XLogP | 4.92 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|