C10H18O2 — CID 139984965
2-methyl-1,3-bis(prop-1-enoxy)propane (PubChem CID 139984965) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-methyl-1,3-bis(prop-1-enoxy)propane.
| Compound Name | 2-methyl-1,3-bis(prop-1-enoxy)propane |
|---|---|
| PubChem CID | 139984965 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-methyl-1,3-bis(prop-1-enoxy)propane |
| SMILES | CC=COCC(C)COC=CC |
| InChI | InChI=1S/C10H18O2/c1-4-6-11-8-10(3)9-12-7-5-2/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | XSDKDVRQOJITDD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|