C12H10N2O2 — CID 139985015
2,7-diaminobiphenylene-1,8-diol (PubChem CID 139985015) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2,7-diaminobiphenylene-1,8-diol.
| Compound Name | 2,7-diaminobiphenylene-1,8-diol |
|---|---|
| PubChem CID | 139985015 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2,7-diaminobiphenylene-1,8-diol |
| SMILES | Nc1ccc2c(c1O)=c1c(O)c(N)ccc1=2 |
| InChI | InChI=1S/C12H10N2O2/c13-7-3-1-5-6-2-4-8(14)12(16)10(6)9(5)11(7)15/h1-4,15-16H,13-14H2 |
| InChIKey | PVUJRTBUTZYGNP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|