C25H25NO6 — CID 139985252
ethyl 2-[3-methoxy-4-[[2-(4-phenoxyphenyl)acetyl]amino]phenoxy]acetate (PubChem CID 139985252) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl 2-[3-methoxy-4-[[2-(4-phenoxyphenyl)acetyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-methoxy-4-[[2-(4-phenoxyphenyl)acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 139985252 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | ethyl 2-[3-methoxy-4-[[2-(4-phenoxyphenyl)acetyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC(=O)Cc2ccc(Oc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H25NO6/c1-3-30-25(28)17-31-21-13-14-22(23(16-21)29-2)26-24(27)15-18-9-11-20(12-10-18)32-19-7-5-4-6-8-19/h4-14,16H,3,15,17H2,1-2H3,(H,26,27) |
| InChIKey | HIFPNDHSZWFYJM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |