C23H24N2O7 — CID 139985432
8-[2-(dimethylamino)ethoxy]-6-imino-7-(6-methoxy-1,3-benzodioxol-5-yl)-7,8-dihydrobenzo[f][1,3]benzodioxol-5-one (PubChem CID 139985432) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 8-[2-(dimethylamino)ethoxy]-6-imino-7-(6-methoxy-1,3-benzodioxol-5-yl)-7,8-dihydrobenzo[f][1,3]benzodioxol-5-one.
| Compound Name | 8-[2-(dimethylamino)ethoxy]-6-imino-7-(6-methoxy-1,3-benzodioxol-5-yl)-7,8-dihydrobenzo[f][1,3]benzodioxol-5-one |
|---|---|
| PubChem CID | 139985432 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 8-[2-(dimethylamino)ethoxy]-6-imino-7-(6-methoxy-1,3-benzodioxol-5-yl)-7,8-dihydrobenzo[f][1,3]benzodioxol-5-one |
| SMILES | [H]/N=C1\C(=O)c2cc3c(cc2C(OCCN(C)C)C1c1cc2c(cc1OC)OCO2)OCO3 |
| InChI | InChI=1S/C23H24N2O7/c1-25(2)4-5-28-23-13-7-17-16(29-10-30-17)6-12(13)22(26)21(24)20(23)14-8-18-19(32-11-31-18)9-15(14)27-3/h6-9,20,23-24H,4-5,10-11H2,1-3H3/b24-21- |
| InChIKey | WSINSNIULDXOLN-FLFQWRMESA-N |
| XLogP | 2.77 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|