C29H32N2O — CID 139985734
2,4,6-trimethyl-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline (PubChem CID 139985734) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline.
| Compound Name | 2,4,6-trimethyl-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 139985734 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2,4,6-trimethyl-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline |
| SMILES | Cc1cc(C)c(NC(=CC2=NC(c3c(C)cc(C)cc3C)CO2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H32N2O/c1-18-12-20(3)28(21(4)13-18)26-17-32-27(30-26)16-25(24-10-8-7-9-11-24)31-29-22(5)14-19(2)15-23(29)6/h7-16,26,31H,17H2,1-6H3 |
| InChIKey | XNPIGJACRIFTEQ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |