C17H11F5N2O — CID 139985773
N-[2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]-2,3,4,5,6-pentafluoroaniline (PubChem CID 139985773) has the molecular formula C17H11F5N2O and a molecular weight of 354.28 g/mol. Its IUPAC name is N-[2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 139985773 |
| Molecular Formula | C17H11F5N2O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]-2,3,4,5,6-pentafluoroaniline |
| SMILES | Fc1c(F)c(F)c(NC(=CC2=NCCO2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C17H11F5N2O/c18-12-13(19)15(21)17(16(22)14(12)20)24-10(8-11-23-6-7-25-11)9-4-2-1-3-5-9/h1-5,8,24H,6-7H2 |
| InChIKey | RRTJLYUPCNEAHG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|