C21H21F3N2O — CID 139985778
2,4,6-trimethyl-N-[3,3,3-trifluoro-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)prop-1-en-2-yl]aniline (PubChem CID 139985778) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[3,3,3-trifluoro-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)prop-1-en-2-yl]aniline.
| Compound Name | 2,4,6-trimethyl-N-[3,3,3-trifluoro-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)prop-1-en-2-yl]aniline |
|---|---|
| PubChem CID | 139985778 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2,4,6-trimethyl-N-[3,3,3-trifluoro-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)prop-1-en-2-yl]aniline |
| SMILES | Cc1cc(C)c(NC(=CC2=NC(c3ccccc3)CO2)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C21H21F3N2O/c1-13-9-14(2)20(15(3)10-13)26-18(21(22,23)24)11-19-25-17(12-27-19)16-7-5-4-6-8-16/h4-11,17,26H,12H2,1-3H3 |
| InChIKey | NCJNRCIYOFFWID-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |